616-38-6 - Names and IdentifiersNameDimethyl carbonateSynonymsDMCMethyl carbonateMETHYL CARBONA
E-posta adresi: info@standard-groups.com
| Adı | Dimethyl carbonate |
| Eşanlamlar | DMC Methyl carbonate METHYL CARBONATE dimetyl carbonate DIMETHYL CARBONATE Dimethyl carbonate methylcarbonate((meo)2co) Carbonic acid dimethyl ester CARBONIC ACID DIMETHYL ESTER DIMETHYL CARBONATE, ANHYDROUS DimethylCarbonateForSynthesis DIMETHYL CARBONATE, REAGENTPLUS |
| CAS'ın | 616-38-6 |
| EINECS'in | 210-478-4 |
| InChI'nin | InChI=1/C3H6O3/c1-5-3(4)6-2/h1-2H3 |
| InChIKey | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
| Moleküler Formül | C3H6O3 |
| Molar Kütlesi | 90.08 |
| Yoğunluk | 1.069 g/mL at 25 °C (lit.) |
| Erime noktası | 2-4 °C (lit.) |
| Boling Point | 90 °C (lit.) |
| Flash Point | 65°F |
| Su Solubility | 139 g/L |
| Çözünürlük | 139g/l |
| Buhar Basıncı | 18 mm Hg ( 21.1 °C) |
| Vapor Densitesi | 3.1 (vs air) |
| Görüntü | Liquid |
| Renk | <50(APHA) |
| Odor | Pleasant |
| Merck'ın | 14.3241 |
| BRN | 635821 |
| Depolama Koşulları | +30 ° C'nin altında saklayın. |
| Kararlılık | Stable. Highly flammable. Incompatible with strong oxidizing agents, potassium t-butoxide. |
| Hassas | Motor duygusu |
| Patlayıcı Sınır | 4.22-12.87%(V) |
| Kırılma Endeksi | n20/D 1.368(lit.) |
| Fiziksel ve Kimyasal Özellikler | Characteristics of colorless transparent liquid, irritating odor. properties is an important organic synthesis intermediates, molecular structure containing carbonyl, methyl and methoxy functional groups, with a variety of reaction properties, in the production of safe and convenient, characteristics of less pollution and easy transportation |
| Kullanım | Used in chemical synthesis of methylating agent and carbonylating agent, widely used in food antioxidants, plant protection agents and other fields |
| Tehlike Simbolleri | F - Flammable |
| Risk Kodları | 11 - Highly Flammable |
| Güvenlik Açıklaması | S9 - Keep container in a well-ventilated place. S16 - Ateşme kaynaklarından uzak tutun. S2017/9/16 - |
| BM Kimlikleri | UN 1161 3/PG 2 |
| WGK Almanya | 1 |
| RTECS | FG0450000 |
| TSCA'nın | Evet. |
| HS Kodu | 2920 90 10 |
| Tehlike Sınıfı | 3 |
| Paketleme Grubu | II |
| Toksiklik | LD50 in rats (g/kg): 13.8 orally; 2.5 dermally; LC50 (4 hr) in rats (mg/l): 140 by inhalation (Ono) |
| Zehirli Materiyaler | Propylene oxide Methyl alcohol Propylene carbonate |
| Aşağıdaki ürünler | Diethyl carbonate Methyl ethyl carbonate asulam Ciprofloxacin |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
