3483-12-3 - Names and IdentifiersNameDL-DithiothreitolSynonymsDTTTPTZL-DTTD-DttSputolysinDithit
E-posta adresi: info@standard-groups.com
| Adı | DL-Dithiothreitol |
| Eşanlamlar | DTT TPTZ L-DTT D-Dtt Sputolysin Dithithreitol Cleland regent Cleland reagent Clelands reagent DL-Dithothreitol DL-Dithiothreitol Cleland's reagent Clelands REDUCTACRYL D-1,4-Dithiothreitol (R,R)-Dithiothreitol 1,4-Dithio-l-threitol Threitol, 1,4-dithio- DL-1,4-Dithiothreitol 1,4-Dithio-DL-threitol 1,4-dithio-dl-threitol sol. DithiothreitollelandsReagenz threo-1,4-Dimercapto-2,3-butanediol 2,4,6-Tri(2-pyridyl)-1,3,5-triazine dithiothreitol (dtt) sequencing grade D-threo-1,4-Dimercapto-2,3-butanediol (R*,R*)-1,4-Dimercapto-2,3-butanediol (2S,3S)-1,4-disulfanylbutane-2,3-diol dithiothreitol molecular biology*reagent 2,3-Butanediol, 1,4-dimercapto-, D-threo- |
| CAS'ın | 3483-12-3 27565-41-9 28823-08-7 28823-08-7 |
| EINECS'in | 248-531-9;222-468-7 |
| InChI'nin | InChI=1/C4H10O2S2/c1-2(5)3(6)4(7)8/h2-8H,1H3 |
| Moleküler Formül | C4H10O2S2 |
| Molar Kütlesi | 154.251 |
| Erime noktası | 42-44℃ |
| Boling Point | 125～130°C |
| Özel Dönüş (α) | -0.2～+0.2°(20℃/D)(c=5,H2O) |
| Su Solubility | Soluble |
| Çözünürlük | Soluble in water, ethanol, acetone, ethyl acetate, chloroform and ether. |
| Görüntü | Beyaz kristal toz |
| Depolama Koşulları | 2-8℃ |
| Hassas | Air and heat and humidity sensitivity |
| Kırılma Endeksi | 1.576 |
| MDL'nin | MFCD00004877 |
| Güvenlik Açıklaması | S24/25 Cilt ve gözlerle temas etmekten kaçının. |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
