Introduction1072-53-3 – Names and IdentifiersName1,3,2-dioxathiolane 2,2-dioxideSynonymsgl
E-posta adresi: info@standard-groups.com
| Adı | 1,3,2-dioxathiolane 2,2-dioxide |
| Eşanlamlar | glycolsulfate Ethylenesulfate 1,2-ETHYLENE SULFATE ethyleneglycol,cyclicsulfate 1,3,2-Dioxathiolane-2,2-Dioxide 1,3,2-dioxathiolane 2,2-dioxide 1,3,2-DIOXATHIOLANE 2,2-DIOXIDE 1,3,2-Dioxathiolane,2,2-dioxides 1,3,2-Dioxathiolan-2,2-oxide (DTD) |
| CAS'ın | 1072-53-3 |
| EINECS'in | 600-809-4 |
| InChI'nin | InChI=1/C2H4O4S/c3-7(4)5-1-2-6-7/h1-2H2 |
| InChIKey | ZPFAVCIQZKRBGF-UHFFFAOYSA-N |
| Moleküler Formül | C2H4O4S |
| Molar Kütlesi | 124.12 |
| Yoğunluk | 1.604±0.06 g/cm3 (20 ºC 760 Torr) |
| Erime noktası | 95-97 °C (lit.) |
| Boling Point | 231.1±7.0℃ (760 Torr) |
| Flash Point | 93.5±18.2℃ |
| Çözünürlük | Chloroform, Methanol |
| Buhar Basıncı | 0.91-1.7Pa at 20-25℃ |
| Görüntü | White to beige powder or crystal |
| Renk | Beyaz-Beyaz |
| Depolama Koşulları | 2-8 ° C |
| Kırılma Endeksi | 1.5090 (estimate) |
| MDL'nin | MFCD00221769 |
| Risk Kodları | 22 – Harmful if swallowed |
| WGK Almanya | 3 |
| RTECS | JH4800000 |
| HS Kodu | 29209085 |
| LogP'nin | -0.45 at 23℃ and pH1.4-1.7 |
| surface tension | 66.8mN/m at 1g/L and 20 ℃ |
| Kullanım | As an additive for the electrolyte of a lithium ion battery, the additive has the function of suppressing the decrease of the initial capacity of the battery, increasing the initial discharge capacity, reducing the expansion of the battery after being placed at a high temperature, and improving the charging and discharging performance and the number of cycles of the battery. Hydroxyethylating reagents for organic synthesis synthesize drug intermediates. It can also be used as a raw material for synthesizing certain heterocyclic compounds for gelatin hardening, antihypertensive drugs and new double surfactants |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
