2-Amino-4-Methoxylpyridine - Names and IdentifiersName2-Amino-4-MethoxylpyridineSynonyms4-metho
E-posta adresi: info@standard-groups.com
| Adı | 2-Amino-4-Methoxylpyridine |
| Eşanlamlar | 4-methoxypyridin-2-amine 4-METHOXYPYRIDIN-2-AMINE 2-AMINO-4-METHOXYPYRIDINE 2-Amino-4-methoxypyridine 4-Methoxy-2-aMinopyridine 4-Methoxy-2-aminopyridine 2-Amino-4-methoxy pyridine 2-AMINO-4-METHOXYLPYRIDINE 2-Amino-4-Methoxylpyridine 4-METHOXY-PYRIDIN-2-YLAMINE 4-Methoxy-Pyridin-2-Ylamine 4-(Methyloxy)-2-pyridinaMine 4-Methoxy-Pyridine-2-ylamine |
| CAS'ın | 10201-73-7 |
| EINECS'in | 202-713-4 |
| InChI'nin | InChI=1/C6H8N2O/c1-9-5-2-3-8-6(7)4-5/h2-4H,1H3,(H2,7,8) |
| InChIKey | QPHBCOSULYSASF-UHFFFAOYSA-N |
| Moleküler Formül | C6H8N2O |
| Molar Kütlesi | 124.14 |
| Yoğunluk | 1.139±0.06 g/cm3(Predicted) |
| Erime noktası | 120-121°C |
| Boling Point | 258.6±20.0 °C(Predicted) |
| Flash Point | 110.2°C |
| Su Solubility | Soluble in Dimethyl sulfoxide, methanol. Slightly soluble in water. |
| Çözünürlük | DMSO, Methanol |
| Buhar Basıncı | 0.0136mmHg at 25°C |
| Görüntü | Kristalan pulu |
| Renk | Pale yellow |
| Maksimum dalga uzunluğu( λmax) | ['280nm(CHCl3)(lit.)'] |
| pKa | 7.79±0.11(Predicted) |
| Depolama Koşulları | Karanlık bir yerde saklayın, inert atmosfer, oda sıcaklığı |
| Hassas | Hava duygusu |
| Kırılma Endeksi | 1.56 |
| MDL'nin | MFCD07437849 |
| Risk Kodları | R22 - Yutulduğunda zararlı R36/37/38 - Gözleri, solunum sistemini ve cildi rahatsız edici. |
| Güvenlik Açıklaması | 36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Almanya | 3 |
| Tehlike Sınıfı | 6.1 |
| tanıtım | 2-amino -4-methoxypyridine has a melting point of 120 to 121 degrees, a boiling point of 258.6±20.0 degrees (under one atmospheric pressure), a density of 1.1, and a yellow or yellow-white solid under normal temperature and pressure. It has good solubility in common organic solvents such as dimethyl sulfoxide, N,N-dimethylformamide, ethyl acetate and alcohol solvents, but it has poor solubility in water. |
| Kullanım | 2-amino-4-methoxypyridine is a common organic synthesis intermediate. Its main purpose is to participate in chiral drug molecules as a molecular skeleton, Bioactive molecules and nitrogen-containing ligands in the synthesis. The amino group in its structure can connect the molecular skeleton to the target molecule through acylation reaction under appropriate conditions. In addition, it has been reported in the literature that under suitable reaction conditions, a halogen atom such as bromine and iodine can be introduced in the para position of the amino group. |
| Sentez metodu | For the synthesis of 2-amino-4-methoxypyridine, the conventional synthesis method is based on its premise 2-bromo-4-methoxypyridine Starting from, under the promotion of appropriate copper salts, the coupling reaction with nitrogen atoms is carried out to obtain the target product. In addition, there is another synthetic route starting from 2-amino-4-chloro-pyridine. With the help of the electron-deficient nature of the pyridine ring, the target product can also be obtained through the aromatic nucleophilic substitution of sodium methoxide. |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
