N-(2-Hydroxyethyl)piperazine - Names and IdentifiersNameN-(2-Hydroxyethyl)piperazineSynonymsNSC
E-posta adresi: info@standard-groups.com
| Adı | N-(2-Hydroxyethyl)piperazine |
| Eşanlamlar | NSC 38969 NSC 26884 NSC 60706 1-Piperazineethanol N-(2-Hydroxyethyl)pi Piperazineethanol, 1- Hydroxyethyl piperazine 2-piperazin-1-ylethanol 2-(1-Piperazino)ethanol 1-piperazin-1-ylethanol 1-(2-Hydroxyethyl)piperazine N-(2-Hydroxyethyl)piperazine N-(2-Hydroxyethyl) piperazine 1-(2-hydroxyethyl)piperazinediium (2E)-3-(naphthalen-2-yl)prop-2-enoic acid 2-(Piperazin-1-yl)ethan-1-ol, 1-Hydroxy-2-(piperazin-1-yl)ethane 1-(2-Hydroxyethyl)piperazine,2-Piperazinoethanol, Piperazine-1-ethanol |
| CAS'ın | 103-76-4 |
| EINECS'in | 203-142-3 |
| InChI'nin | InChI=1/C6H14N2O/c1-6(9)8-4-2-7-3-5-8/h6-7,9H,2-5H2,1H3 |
| Moleküler Formül | C6H14N2O |
| Molar Kütlesi | 130.19 |
| Yoğunluk | 1.061g/mLat 25°C(lit.) |
| Erime noktası | -38.5 °C |
| Boling Point | 246°C(lit.) |
| Flash Point | > 230°F |
| Su Solubility | MISCIBLE |
| Çözünürlük | Chloroform (Slightly), Methanol (Slightly) |
| Buhar Basıncı | 0.007 hPa (20 °C) |
| Görüntü | Transparent, bright yellow liquid |
| Özel Yerçekimi | 1.060 |
| Renk | Renksiz sarıya temizle |
| BRN | 104361 |
| pKa | 14.96±0.10(Predicted) |
| PH | 12.3 (100g/l, H2O, 20℃) |
| Depolama Koşulları | +30 ° C'nin altında saklayın. |
| Patlayıcı Sınır | 1.4-8.9%(V) |
| Kırılma Endeksi | n20/D 1.506(lit.) |
| MDL'nin | MFCD00005970 |
| Fiziksel ve Kimyasal Özellikler | The boiling point of 246 deg C, the relative density of 1.061, refractive index of 1.5065. |
| Kullanım | It is an important intermediate for the production of triethylenediamine, surfactants, pharmaceuticals and pesticides, and can be used to synthesize fluphenazine, a psychiatric drug, etc. |
| Tehlike Simbolleri | Xi - Kızdırıcı |
| Risk Kodları | R36/37/38 - Gözleri, solunum sistemini ve cildi rahatsız edici. R41 - Gözlere ciddi hasar riski R38 - Irritating to the skin |
| Güvenlik Açıklaması | S26 - Gözlerle temas halinde hemen bol miktarda suyla durulayın ve tıbbi tavsiye alın. S36/39 - S37/39 Uygun eldiven ve göz/yüz koruması giyin |
| WGK Almanya | 1 |
| RTECS | TL6825000 |
| TSCA'nın | Evet. |
| HS Kodu | 29335995 |
| Hazır Not | Kızgın |
| Toksiklik | LD50 orally in Rabbit: 4000 mg/kg LD50 dermal Rabbit > 5000 mg/kg |
| LogP'nin | -1.47 at 25℃ |
| NIST kimyasal bilgi | Verilen bilgiler: webbook.nist.gov (dış bağlantı) |
| EPA kimyasal bilgileri | Tarafından sağlanan bilgiler: ofmpub.epa.gov (dış bağlantı) |
| kullan | is an important intermediate in the production of triethylenediamine, surfactant, medicine and pesticide. it can be used in the synthesis of psychotic fluphenazine, etc. it is used in organic synthesis and is an important intermediate in the production of triethylenediamine, surfactant, medicine and pesticide. It can also be used to synthesize psychotic fluphenazine, etc. |
| Üretim yöntemi | It is obtained by the reaction of piperazine hexahydrate and ethylene oxide. Dissolve piperazine hexahydrate in water, stir and cool to 15-20°C, and pass in ethylene oxide. After the passage is completed, the reaction is stirred at 30-35 ℃ for 2 hours, and the 90% of the original water added amount is steamed by heating. Cold to below 15 ℃, filter. The filtrate was distilled under reduced pressure, and the fraction at 145-155 ℃(5.33kPa) was collected to obtain N-(2-hydroxyethyl) piperazine. |
| spontan yanma sıcaklığı | 280°C |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
