3-(Acetylamino)-3-(4-Nitrophenyl)Propanoic Acid - Names and IdentifiersName3-(Acetylamino)-3-(4
E-posta adresi: info@standard-groups.com
Adı | 3-(Acetylamino)-3-(4-Nitrophenyl)Propanoic Acid |
Eşanlamlar | 3-Acetamido-3-(4-nitrophenyl)propanoic acid 3-ACETYLAMINO-3-(4-NITRO-PHENYL)-PROPIONIC ACID Benzenepropanoic acid, β-(acetylamino)-4-nitro- 3-Acetylamino-3-(4-Nitro-Phenyl)-Propionic Acid 3-(ACETYLAMINO)-3-(4-NITROPHENYL)PROPANOIC ACID 3-(Acetylamino)-3-(4-Nitrophenyl)Propanoic Acid |
CAS'ın | 100061-23-2 |
InChI'nin | InChI=1/C11H12N2O5/c1-7(14)12-10(6-11(15)16)8-2-4-9(5-3-8)13(17)18/h2-5,10H,6H2,1H3,(H,12,14)(H,15,16) |
Moleküler Formül | C11H12N2O5 |
Molar Kütlesi | 252.22 |
Yoğunluk | 1.363g/cm3 |
Boling Point | 545.9°C at 760 mmHg |
Flash Point | 283.9°C |
Buhar Basıncı | 9.47E-13mmHg at 25°C |
Depolama Koşulları | 2-8 ° C |
Kırılma Endeksi | 1.578 |
Tehlike Simbolleri | Xi - Kızdırıcı |
Hazır Not | Kızgın |
3-Acetamido-3-p-nitrophenyl-propionic acid (abbreviated as ANP) is an organic compound with the chemical formula C11H12N2O5. The following is a description of the nature, use, formulation and safety information of ANP:
Doğal:
1. Appearance: ANP is white or light yellow crystalline powder.
2. Solubility: Soluble in organic solvents such as chloroform, acetone and ethanol, insoluble in water.
Hazırlama Yöntemi:
ANP can be obtained by reacting p-nitroacetophenone with ethanolamine. The specific preparation steps are as follows:
1. Add p-nitroacetophenone and ethanolamine to the reaction flask at a molar ratio of 1:1.
2. The reaction is carried out under appropriate temperature conditions, and acidic or alkaline catalysts are commonly used.
3. After completion of the reaction, the ANP product was obtained by filtration or crystallization.
Güvenlik Bilgileri:
1. ANP is an organic nitrate compound, which is explosive and irritating. Please pay attention to prevent it from being exposed to open fire, high temperature and irritants.
2. Wear appropriate protective equipment, such as gloves, face masks, and protective clothing, when using or preparing ANP.
3. ANP should be stored in a dry, sealed, cool place, away from fire and flammable materials.
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com