Product Name 4-Aminobutyric Acid4-Multiple Names Aminobutyric Acid;Gaba;Gamma-Aminobutyric Acid;Pipe
E-posta adresi: info@standard-groups.com
It is used in biochemical research and medicine to treat various diseases caused by liver coma and cerebrovascular disorders. Advantage of 4-Aminobutyric Acid CAS No. 56-12-2 It has deliquescence, very soluble in water, slightly soluble in hot ethanol, insoluble in cold ethanol, ether and benzene It is widely used in chemical field.
| Adı | 4-Aminobutyric acid |
| Eşanlamlar | Gaba aurora ka-1053 AURORA KA-1053 piperidic acid piperidinic acid 4-AMINOBUTYRIC ACID 4-Aminobutyric acid γ-aminobutyric acid aminobutyric-4 acid AMINOBUTYRIC-4 ACID 4-amino butyric acid 4-AMINOBUTANOIC ACID 4-aminobutanoic acid h-4-aminobutyric acid AMINOBUTYRIC ACID, 4- H-4-AMINOBUTYRIC ACID aminobutyric acid, 4- 4-AMINO-N-BUTYRIC ACID 4-amino-n-butyric acid gamma-aminobutyric acid gamma aminobutyric acid ALPHA-AMINOBUTANOIC ACID gamma.-aminobutyric acid alpha-aminobutanoic acid |
| CAS'ın | 56-12-2 |
| EINECS'in | 200-258-6 |
| InChI'nin | InChI=1/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) |
| InChIKey | BTCSSZJGUNDROE-UHFFFAOYSA-N |
| Moleküler Formül | C4H9NO2 |
| Molar Kütlesi | 103.12 |
| Yoğunluk | 1.2300 (estimate) |
| Erime noktası | 195 °C (dec.) (lit.) |
| Boling Point | 248.0±23.0 °C(Predicted) |
| Flash Point | 103.8°C |
| JECFA Numarası | 1771 |
| Su Solubility | SOLUBLE |
| Çözünürlük | Easily soluble in water, slightly soluble in hot ethanol, insoluble in cold ethanol, ether and benzene |
| Buhar Basıncı | 0.00798mmHg at 25°C |
| Görüntü | Beyaz kristal |
| Renk | White to almost white |
| Merck'ın | 14,430 |
| BRN | 906818 |
| pKa | 4.031(at 25℃) |
| Depolama Koşulları | 2-8 ° C |
| Kırılma Endeksi | 1.4650 (estimate) |
| MDL'nin | MFCD00008226 |
| Fiziksel ve Kimyasal Özellikler | Appearance: white or off-white crystalline powder, with slightly odor and slightly bitter taste. |
| Kullanım | Can reduce blood ammonia, promote brain metabolism. For the treatment of various types of liver Coma, also used for brain stroke sequelae, cerebral arteriosclerosis, head trauma sequelae and uremia, gas poisoning caused by Coma. |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
