Product Name4-Benzoylbiphenyl4-Multiple NamesBenzoylbiphenyl;(1,1-Biphenyl)-4-Yl)Phenylmethanone;5-P
E-posta adresi: info@standard-groups.com
UV-curable coatings and inks are important intermediates for the synthesis of bifonazole and photosensitizers for photosensitive resins. Intermediate of antifungal drug bifonazole. Advantage of 4-Benzoylbiphenyl CAS No. 2128-93-0 It is no harm It can prevent hydrogen peroxide from being damaged by catalysiser It is wided used and accept by market
| Adı | 4-Benzoylbiphenyl |
| Eşanlamlar | 4-Benzoylbiphenyl Photoinitiator-PBZ 4-Phenybenzophenone P-PHENYLBENZOPHENONE 4-Phenylbenzophenone 4-PHENYLBENZOPHENONE 4-Phenyl benzopehone 4-Phenyl Benzophenone LABOTEST-BB LT00159468 4-biphenylylphenylketone 4-Diphenyl phenyl ketone 4-Biphenylyl phenyl ketone biphenyl-4-yl(phenyl)methanone (1,1'-biphenyl)-4-ylphenyl-methanon [1,1'-biphenyl]-4-ylphenyl-methanon [1,1'-biphenyl]-4-ylphenyl-Methanone ((1,1-Biphenyl)-4-yl)phenylmethanone ((1,1'-Biphenyl)-4-yl)phenylmethanone 4-Benzoylbiphenyl[1,1'-biphenyl]-4-ylphenyl-Methanone |
| CAS'ın | 2128-93-0 |
| EINECS'in | 218-345-2 |
| InChI'nin | InChI=1/C19H14O/c20-19(17-9-5-2-6-10-17)18-13-11-16(12-14-18)15-7-3-1-4-8-15/h1-14H |
| InChIKey | LYXOWKPVTCPORE-UHFFFAOYSA-N |
| Moleküler Formül | C19H14O |
| Molar Kütlesi | 258.31 |
| Yoğunluk | 1.0651 (rough estimate) |
| Erime noktası | 99-101°C(lit.) |
| Boling Point | 419-420°C(lit.) |
| Flash Point | 184.3°C |
| Su Solubility | 73.6μg/L at 20℃ |
| Çözünürlük | Chloroform (Slightly), Methanol (Slightly, Heated) |
| Buhar Basıncı | 0Pa 20°C |
| Görüntü | grayish crystalline powder |
| Renk | Beyaz-Beyaz |
| BRN | 1876092 |
| Depolama Koşulları | Kuru, oda sıcaklığı |
| Kırılma Endeksi | 1.5500 (estimate) |
| MDL'nin | MFCD00003079 |
| Fiziksel ve Kimyasal Özellikler | Melting point 99-103°C crystalline compound. |
| Kullanım | Used as pharmaceutical intermediates and photoinitiator |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
