Product NameChlorodiphenylphosphineMultiple NamesChlorodiphenylphosphine;Diphenyl Chlorophosphine;Di
E-posta adresi: info@standard-groups.com
Used in organic synthesis and as an intermediate of pesticides, pharmaceuticals and dyes, one of the important raw materials for the production of photoinitiator TPO. Aslo used in organic synthesis and as intermediates of pesticides, pharmaceuticals and dyes. Advantage of Chlorodiphenylphosphine CAS No. 1079-66-9 Stable under normal temperature and pressure Widely used in the preparation of anti-UV agents, organophosphorus flame retardants, antioxidants, plasticizers and asymmetric synthesis catalysts Easy to stock
| Adı | Chlorodiphenylphosphine |
| Eşanlamlar | DPC DPPC Aurora Ka-1322 AURORA KA-1322 Chlorodiphenylphospine CHLORODIPHENYLPHOSPHINE Diphenylchlorophosphine DIPHENYLCHLOROPHOSPHINE Diphenylphosphinchlorid Chlorodiphenylphosphine Diphenyl chlorophosphine P-Chlorodiphenylphosphine diphenylphosphine Chloride Phosphine, Chlorodiphenyl- Phosphine, chlorodiphenyl- diphenyl-phosphinouschlorid Diphenyl phosphine chloride diphenylphosphonium chloride Diphenylphosphinous Chloride DIPHENYLPHOSPHINOUS CHLORIDE |
| CAS'ın | 1079-66-9 |
| EINECS'in | 214-093-2 |
| InChI'nin | InChI:1S/C12H10ClP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | XGRJZXREYAXTGV-UHFFFAOYSA-N |
| Moleküler Formül | C12H10ClP |
| Molar Kütlesi | 220.63 |
| Yoğunluk | 1.229g/mLat 25°C(lit.) |
| Erime noktası | 14-16°C |
| Boling Point | 320°C(lit.) |
| Flash Point | > 230°F |
| Su Solubility | Reacts violently |
| Çözünürlük | Miscible with alcohol. Slightly miscible with ammonia. |
| Buhar Basıncı | 1.3 hPa (20 °C) |
| Vapor Densitesi | 7.8 (vs air) |
| Görüntü | Liquid |
| Özel Yerçekimi | 1.229 |
| Renk | Colorless to yellow |
| BRN | 512032 |
| Depolama Koşulları | +30 ° C'nin altında saklayın. |
| Hassas | Air & Moisture Sensitive |
| Kırılma Endeksi | n20/D 1.636(lit.) |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
