Chemical Name: 2,6-DifluorobenzamideCAS No.:18063-03-1Assay: ≥99% Appearance: white to off-white pow
E-posta adresi: info@standard-groups.com
2,6-Difluorobenzamide Usage： Used as pharmaceutical intermediate and Pesticide intermediate 2,6-Difluorobenzamide Packaging and Shipping： 25KG/drum 2,6-Difluorobenzamide Storage: Keep container sealed and store in an ventilated, low temperature, dry warehouse, separate from foods and oxidizing agents.
| Adı | 2,6-Difluorobenzamide |
| Eşanlamlar | uorobenzamide 2,6-Difluorbenzamid 2,6-Difluorobenzamide 2,6-Difluorobenzoylamide Fluorine benzaMide 2, 6-2 2,6-difluorobenzoic acid amide |
| CAS'ın | 18063-03-1 |
| EINECS'in | 241-972-8 |
| InChI'nin | InChI=1/C7H5F2NO/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
| InChIKey | AVRQBXVUUXHRMY-UHFFFAOYSA-N |
| Moleküler Formül | C7H5F2NO |
| Molar Kütlesi | 157.12 |
| Yoğunluk | 1,199g/cm |
| Erime noktası | 145-148 °C (lit.) |
| Boling Point | 51-52C/15Tor |
| Flash Point | 67.3°C |
| Çözünürlük | ethanol: soluble5%, clear to turbid, colorless to light yellow |
| Buhar Basıncı | 0.622mmHg at 25°C |
| Görüntü | Beyaz kristal |
| Renk | Beyaz |
| BRN | 2047480 |
| pKa | 14.54±0.50(Predicted) |
| Depolama Koşulları | Kuru, oda sıcaklığı |
| Kırılma Endeksi | 1,508 |
| MDL'nin | MFCD00007972 |
| Fiziksel ve Kimyasal Özellikler | Appearance: White-like crystals |
| Kullanım | It can be used as an intermediate for the synthesis of fluorinated benzoylurea pesticides, and can be used as a variety of insecticides and acaricides, such as fluifolide, difenuron, and difenuron. It is also used in medicine; Intermediates in pesticides and intermediates in organic synthesis for the synthesis of fluorobenzenes Acyl urea pesticide intermediates, from which can be prepared by the fluoride, borteuron, difenuron and other insecticidal, acaricide. It is also used in medicine, liquid crystal materials. |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
