Chemical Name: Chlorotrimethylsilane / Trimethyl silicon chlorideCAS No.: 75-77-4Assay: ≥99.0% Appea
E-posta adresi: info@standard-groups.com
Chlorotrimethylsilane / Trimethyl silicon chloride Usage： The product is mainly used as an intermediate in the production of organic silicon polymer and other products, and also used as a high molecular compound sealing agent, desiccant, dehydrating agent, high temperature adhesive and resin raw materials. It is used for the synthesis of cephalosporin I and cephalosporin V in pharmaceutical production. Chlorotrimethylsilane / Trimethyl silicon chloride Packaging and Shipping： 170KG/drum or as per buyer requirement Chlorotrimethylsilane / Trimethyl silicon chloride Storage: Store in ventilated low temperature dry warehouse; Store separately from oxidants and acids.
| Adı | Chlorotrimethylsilane |
| Eşanlamlar | TMCS TMSCL SILANE M3 (CH3)3SiCl CHLOROTRIMETHYLSILANE Trimethylchlorosilane Chlorotrimethylsilane Trimethylchlorsosilane Trimethylsilyl chloride TRIMETHYLSILYL CHLORIDE TRIMETHYL SILICON CHLORIDE DOW CORNING(R) PRODUCT Z-1224 TMS chloride~Trimethylchlorosilane~Trimethylsilyl chloride |
| CAS'ın | 75-77-4 |
| EINECS'in | 200-900-5 |
| InChI'nin | InChI=1/C3H9Si.ClH/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
| InChIKey | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
| Moleküler Formül | C3H9ClSi |
| Molar Kütlesi | 108.64 |
| Yoğunluk | 0.857g/mLat 25°C |
| Erime noktası | −40°C(lit.) |
| Boling Point | 57°C(lit.) |
| Flash Point | 104°F |
| Su Solubility | REACTS |
| Çözünürlük | Miscible with ether, benzene, diethylether and perchloroethylene. |
| Buhar Basıncı | 100 mm Hg ( 25 °C) |
| Vapor Densitesi | 3.7 (vs air) |
| Görüntü | Liquid |
| Özel Yerçekimi | 0.8536 (27℃) |
| Renk | Renksiz temizle |
| BRN | 1209232 |
| Depolama Koşulları | +30 ° C'nin altında saklayın. |
| Kararlılık | Stable. Highly flammable - note low flash point. Reacts violently with water. Incompatible with water, moisture, strong oxidizing agents, strong acids, strong bases, aldehydes, alcohols, amines, ester |
| Hassas | 8: nem, su, protik çözücülerle hızlı bir şekilde tepki verir |
| Patlayıcı Sınır | 1.5-46%(V) |
| Kırılma Endeksi | n20/D 1.500 |
| Fiziksel ve Kimyasal Özellikler | Colorless volatile flammable liquid. melting point -57.7 ℃ boiling point 57.7 ℃ relative density 0.8580 refractive index 1.3885 flash point 27.8 ℃ solubility, ethyl ether and perchloroethylene. |
| Kullanım | Can be used to produce a variety of organic silicon compounds, is the main raw material for the production of hexamethyldisilazane (amine) and hexamethyldisiloxane |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
