Chemical Name: 1-BromoadamantaneCAS No.: 768-90-1Assay: ≥98.0%Appearance: White-like crystalline pow
E-posta adresi: info@standard-groups.com
1-Bromoadamantane Usage： Pharmaceutical Intermediates,It is an intermediate in the synthesis of amkanane salt. 1-Bromoadamantane Packaging and Shipping： 25KG/drum or as per buyer's requirements 1-Bromoadamantane Storage: Storage in ventilated low temperature dry warehouse; Keep container closed and separately from open flame and heat source.
| Adı | 1-Bromoadamantane |
| Eşanlamlar | 1-BroMoadaMantan Adamantyl bromide 1-Bromoadamantane 1-bromoadmantance 3-Bromoadamantane 1-Bromoadamamtane 1-Bromo adamantine 1-Adamantyl bromide 11 -BROMOADAMANTANE RARECHEM AQ TC 1019 Adamantane, 1-bromo- LABOTEST-BB LT00239617 1-broMine adaMantanone 1-BROMOADAMANTANE FOR SYNTHESIS 1-bromotricyclo(3.3.1.13,7)decane 1-Bromotricyclo[3.3.1.1(3,7)]decane 1-Bromotricycol[3.3.1.1.(1,7)decane 1-Bromotricyclo[3.3.1.1(3.7)]decane 1-Bromoadamantane,1-Adamantyl bromide |
| CAS'ın | 768-90-1 |
| EINECS'in | 212-200-7 |
| InChI'nin | InChI=1/C10H15Br/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2/t7-,8+,9-,10- |
| InChIKey | VQHPRVYDKRESCL-UHFFFAOYSA-N |
| Moleküler Formül | C10H15Br |
| Molar Kütlesi | 215.13 |
| Yoğunluk | 1.2686 (rough estimate) |
| Erime noktası | 116-118 °C (lit.) |
| Boling Point | 248.79°C (rough estimate) |
| Flash Point | 96.4°C |
| Su Solubility | It is soluble in organic solvents and insoluble in water. |
| Çözünürlük | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| Buhar Basıncı | 0.0587mmHg at 25°C |
| Görüntü | White to white-like crystals |
| Renk | Beyaz sarıya |
| BRN | 1098857 |
| Depolama Koşulları | Inert atmosfer, Oda Sıcaklığı |
| Hassas | Motor duygusu |
| Kırılma Endeksi | 1.6411 (estimate) |
| MDL'nin | MFCD00074721 |
| Fiziksel ve Kimyasal Özellikler | Melting point 116-118 ° C, soluble in chloroform. |
| Kullanım | Intermediates in the synthesis of amantadine hydrochloride |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
