Chemical Name: 2-Chloro-1,4-naphthoquinoneCAS No.: 1010-60-2Assay: ≥99.0% Appearance: Yellow crystal
E-posta adresi: info@standard-groups.com
2-Chloro-1,4-naphthoquinone Usage： Mainly used as pharmaceutical intermediates, atovaquone intermediates. 2-Chloro-1,4-naphthoquinone Packaging and Shipping： 25KG/drum or as per buyer requirement 2-Chloro-1,4-naphthoquinone Storage: Storage in ventilated low temperature dry warehouse; Keep container closed and separately from open flame and heat source.
| Adı | 2-chloro-1,4-Naphthoquinone |
| Eşanlamlar | AURORA KA-5008 RARECHEM BW GC 0008 2-chloronaphthoquinone 2-Chloronaphthoquinone 2-chloro-4-naphthoquinone 2-CHLORO-1,4-NAPHTHOQUINONE 2-chloro-1,4-Naphthoquinone 1,4-Naphthoquinone, 2-chloro- 2-CHLORO-1,4-NAPHTHALENEDIONE 1,4-naphthoquinone, 2-chloro- 2-chloronaphthalene-1,4-dione 2-chloro-1,4-naphthalenedione 1,4-Naphthalenedione, 2-chloro- 1,4-naphthalenedione, 2-chloro- |
| CAS'ın | 1010-60-2 |
| EINECS'in | 213-776-2 |
| InChI'nin | InChI=1/C10H5ClO2/c11-8-5-9(12)6-3-1-2-4-7(6)10(8)13/h1-5H |
| InChIKey | CCTJHVLTAJTPBV-UHFFFAOYSA-N |
| Moleküler Formül | C10H5ClO2 |
| Molar Kütlesi | 192.6 |
| Yoğunluk | 1.42±0.1 g/cm3(Predicted) |
| Erime noktası | 108-109°C |
| Boling Point | 308.0±42.0 °C(Predicted) |
| Flash Point | 129.3°C |
| Çözünürlük | Chloroform (Slightly) |
| Buhar Basıncı | 0.000701mmHg at 25°C |
| Görüntü | Kristalan pulu |
| Renk | Yellow to Dark Yellow |
| Maksimum dalga uzunluğu( λmax) | ['333nm(Hexane)(lit.)'] |
| Depolama Koşulları | Kuru,2-8°C |
| Kararlılık | Motor duygusu |
| Kırılma Endeksi | 1.625 |
| MDL'nin | MFCD00029187 |
| Fiziksel ve Kimyasal Özellikler | Melting Point: 119-122°C flash point: 141°C Appearance: yellowish |
| Kullanım | Intermediate of atropine |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
