Chemical Name: 3-Mercaptopropionic acidSynonyms: 3-MPA; 3-mercaptopropionic; CAS No.: 107-96-0Molecu
E-posta adresi: info@standard-groups.com
3-Mercaptopropionic acid Details: 3-Mercaptopropionic acid (3MPA) is used as a self-assembled monomolecular layer (SAM) with thiol and carboxyl groups. It has a short carbon chain and is mainly used as a capping agent for various nanoparticles. 3-Mercaptopropionic acid Usage: ● Construction field: Retarding polyester water reducing agent PCA and polyetherwater reducing agent PCE. ● Pharmaceutical field: 3-Mercaptopropionic acid is the intermediate of pharmaceutical Chlormezanone and is also used as a stabilizer of PVC. ● 3-Mercaptopropionic acid/3-MPA CAS 107-96-0 electronic grade, used for Electronic chemical materials; ● 3-Mercaptopropionic acid/3-MPA CAS 107-96-0 Optical resin grade, used for High-end resin materials like Optical resin; ● Like thioglycolic acid, it can be used in transparent products with excellent thermal stability and is superior to other stabilizers. ● It is also used as an antioxidant, catalyst and biochemical reagent. 3-Mercaptopropionic acid Packaging and Shipping: Package:250kg/drum;1250kg/IBC drum or as per buyer requirement shipping:UN 2922 8/PG 2 3-Mercaptopropionic acid Storage: Stored in a dry and ventilated warehouse; keep away from sunshine; avoid fire; avoid moisture.
| Adı | 3-Mercaptopropionic acid |
| Eşanlamlar | Thiopropionic acid 3-thiopropionicacid 3-mercaptopropionic 3-sulfanylpropanoate 3-Thiopropionic acid 3-mercpato-propionicaci Mercapto Propionic Acid 3-mercapto-propionicaci 3-Mercaptopropanoic Acid 3-Mercaptopropionic acid 3-sulfanylpropanoic acid 3-Sulfanylpropanoic acid beta-mercaptopropanoicacid acidemercapto-3propionique |
| CAS'ın | 107-96-0 |
| EINECS'in | 203-537-0 |
| InChI'nin | InChI=1/C3H6O2S/c4-3(5)1-2-6/h6H,1-2H2,(H,4,5)/p-1 |
| InChIKey | DKIDEFUBRARXTE-UHFFFAOYSA-N |
| Moleküler Formül | C3H6O2S |
| Molar Kütlesi | 106.14 |
| Yoğunluk | 1.218 g/mL at 25 °C (lit.) |
| Erime noktası | 15-18 °C (lit.) |
| Boling Point | 110-111 °C/15 mmHg (lit.) |
| Flash Point | 201°F |
| JECFA Numarası | 1936 |
| Su Solubility | çözünür |
| Buhar Basıncı | 0.04 mm Hg ( 20 °C) |
| Görüntü | Crystalline Powder, Crystals, and/or Chunks |
| Özel Yerçekimi | 1.218 |
| Renk | Beyaz |
| BRN | 773807 |
| pKa | pK1:;pK2:10.84(SH) (25°C) |
| PH | 2 (120g/l, H2O, 20℃) |
| Depolama Koşulları | +30 ° C'nin altında saklayın. |
| Hassas | Hava duygusu ve Hygroscopic |
| Patlayıcı Sınır | 1.60%(V) |
| Kırılma Endeksi | n20/D 1.492(lit.) |
| Fiziksel ve Kimyasal Özellikler | Density 1.218 melting point 17-19°C boiling point 110-111°C (15 mmHg) refractive index 1.491-1.493 flash point 93°C water soluble |
| Kullanım | For pharmaceutical intermediates, electronic chemicals, etc |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
