English name: 3-Aminobenzoic acid CAS NO.: 99-05-8 Molecular formula: C7H7NO2 Molecular weight: 137.
E-posta adresi: info@standard-groups.com
English name: 3-Aminobenzoic acid CAS NO.: 99-05-8 Molecular formula: C7H7NO2 Molecular weight: 137.14 Standard: enterprise standard Content: ≥99% Packaging: 5kg/bag
M-aminobenzoic acid is mainly used in the synthesis of pharmaceutical intermediates, white or light yellow crystals. M-aminobenzoic acid is soluble in acetone, soluble in boiling water, hot alcohol, hot chloroform and ether, slightly soluble in cold water, cold alcohol and cold chloroform, insoluble in benzene and gasoline, sweet, sublimation.
pharmaceutical and dye intermediates. Used in the manufacture of azo dyes, pharmaceutical ethyl iodide acid and bile acid, reagent.
used as photographic and pharmaceutical intermediates.
| Adı | 3-Aminobenzoic acid |
| Eşanlamlar | 3-Abz-OH 3-aminobenzoate 3-Aminobenzoic acid M-amino benzoic acid Aminobenzoic acid, 3- Between the aMino acid Mesalamine EP Impurity D Aminobenzenecarboxylic acid 3-AMINOBENZOIC ACID FOR SYNTHESIS |
| CAS'ın | 99-05-8 |
| EINECS'in | 202-724-4 |
| InChI'nin | InChI=1/C7H7NO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,8H2,(H,9,10)/p-1 |
| Moleküler Formül | C7H7NO2 |
| Molar Kütlesi | 137.14 |
| Yoğunluk | 1,51 g/cm3 |
| Erime noktası | 178-180°C(ışık.) |
| Boling Point | 251.96°C (zor tahmin) |
| Flash Point | 150°C |
| Su Solubility | 5.9 g/L (15 ºC) |
| Çözünürlük | Soluble in acetone, soluble in boiling water, hot ethanol, hot chloroform, slightly soluble in cold water, cold ethanol and cold chloroform, insoluble in benzene and gasoline. It's irritating. Solubility: 5.9g/l water (15°C) ,3g/100g ethanol, slightly soluble in ether |
| Buhar Basıncı | 1.41E-05mmHg at 25°C |
| Görüntü | Beyaz kristal |
| Renk | White-brownish to beige-brown |
| Odor | Odorless |
| Merck'ın | 14,421 |
| BRN | 471603 |
| pKa | 4.78(at 25℃) |
| Depolama Koşulları | Karanlık bir yerde saklayın, inert atmosfer, oda sıcaklığı |
| Hassas | Işığa duyarlı |
| Kırılma Endeksi | 1.5323 (tahmin et) |
| MDL'nin | MFCD00007795 |
| Fiziksel ve Kimyasal Özellikler | White or yellowish crystals. Melting point 174 ℃, relative density 1.5105(20/4 ℃). Soluble in acetone, soluble in boiling water, hot alcohol, hot chloroform and ether, slightly soluble in cold water, cold alcohol and cold chloroform, insoluble in benzene and gasoline. Sweet. Can sublimate. |
| Kullanım | Used as photographic and pharmaceutical intermediates |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
