Name: 7-Methoxy-1-tetraloneCAS: 6836-19-7Appearance: yellowish or white powderAssay: ≥99%Capacity: 1
E-posta adresi: info@standard-groups.com
Molecular Formula: C11H12O2 Formula Weight: 176.21 CAS No.: 6836-19-7
Name: 7-Methoxy-1-tetralone
CAS: 6836-19-7
Appearance: yellowish or white powder
Assay: ≥99%
Yetenek: 100mt/year
Min.packing: 1 gram
Application: Agomelatine intermediate
Standart: enterprise export
7-Methoxy-1-Naphthanone is an organic compound. The following introduces its nature, purpose, manufacturing method, and safety information:
doğa:
-Appearance: 7-Methoxy-1-Naphthanone is a white crystal or crystalline powder.
-Solubility: Dissolves in organic solvents such as ethanol, ether, and benzene, slightly soluble in water.
Görev:
Üretim yöntemi:
-A common preparation method is to obtain 7-methoxy-1-naphthoquinone by ester hydration reaction of methyl chloride ester and naphthone.
Güvenlik Bilgileri:
-When operating, it is necessary to avoid inhaling its dust or solution, and appropriate personal protective equipment such as gloves, glasses, and laboratory coats should be worn.
-It should be stored in a cool, dry, and well ventilated place, avoiding contact with oxidants and sources of fire.
| Adı | 7-methoxy-1-tetralone |
| Eşanlamlar | 7-M 7-Methoxy-1-tetralon 7-methoxy-1-tetralone 7-methoxyl-1-tetralone 7-Methoxy-1-tetralinone 7-methoxytetralin-1-one 7-Methoxy-1-oxotetraline 3,4-Dihydro-7-methoxy-1(2H)-naphthalenone 7-methoxy-3,4-dihydronaphthalen-1(2H)-one 7-methoxy-1,2,3,4-tetrahydronaphthalen-1-one 7-Methoxy-1,2,3,4-tetrahydronaphthalene-1-one |
| CAS'ın | 6836-19-7 |
| EINECS'in | 229-916-0 |
| InChI'nin | InChI=1/C11H12O2/c1-13-9-6-5-8-3-2-4-11(12)10(8)7-9/h5-7H,2-4H2,1H3 |
| InChIKey | GABLTKRIYDNDIN-UHFFFAOYSA-N |
| Moleküler Formül | C11H12O2 |
| Molar Kütlesi | 176.21 |
| Yoğunluk | 1.124±0.06 g/cm3(Önceden) |
| Erime noktası | 59-63 °C (lit.) |
| Boling Point | 160-165 C |
| Flash Point | 145.8°C |
| Su Solubility | 309mg/L at 25℃ |
| Çözünürlük | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| Buhar Basıncı | 0.000535mmHg at 25°C |
| Görüntü | Beyaz kristal |
| Renk | Beyaz ve beyaz |
| BRN | 2208389 |
| Depolama Koşulları | Kuru, oda sıcaklığı |
| Kırılma Endeksi | 1.548 |
| MDL'nin | MFCD00001696 |
| Kullanım | Used as a pharmaceutical intermediate. |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
