563-47-3 - Names and IdentifiersName3-Chloro-2-methylpropeneSynonymsMACclorurodimetallileMethal
E-posta adresi: info@standard-groups.com
| Adı | 3-Chloro-2-methylpropene |
| Eşanlamlar | MAC clorurodimetallile Methallyl Chloride Cloruro di metallile chloruredemethallyle 2-methylallyl chloride Chlorure de methallyle beta-Methallyl chloride beta-methylallylchloride 3-Chloro-2-methylpropene beta-Methylallyl chloride 3-Chloro-2-Methylpropylene chloruedemethallyle(french) 3-chloro-2-methylprop-1-ene chloruredemethallyle(french) |
| CAS'ın | 563-47-3 |
| EINECS'in | 209-251-2 |
| InChI'nin | InChI=1/C4H7Cl/c1-4(2)3-5/h1,3H2,2H3 |
| Moleküler Formül | C4H7Cl |
| Molar Kütlesi | 90.55 |
| Yoğunluk | 0.925 g/mL at 20 °C (lit.) |
| Erime noktası | -80 °C (lit.) |
| Boling Point | 71-72 °C (lit.) |
| Flash Point | 9°F |
| Su Solubility | 0.5 g/L (20 ºC) |
| Çözünürlük | H2O: çözünmez |
| Buhar Basıncı | 102 mm Hg ( 20 °C) |
| Vapor Densitesi | 3.12 (vs air) |
| Görüntü | Liquid |
| Renk | Clear |
| Merck'ın | 14,2148 |
| BRN | 878160 |
| Depolama Koşulları | 2-8 ° C |
| Patlayıcı Sınır | 2.2-10.4%(V) |
| Kırılma Endeksi | n20/D 1.427(lit.) |
| Fiziksel ve Kimyasal Özellikler |
|
| Kullanım | For the synthesis of acaricidal tin, sodium methallyl sulfonate, 3-chloro-2-methyl-epoxypropane |
| Risk Kodları | R11 - Çok ateşlenebilirPlease take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML R20/22 - Nefes almak ve yutmak zorunda. R34 - Yanıklara neden olur Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML R51/53 Su organizmaları için toksik, su ortamında uzun vadeli olumsuz etkilere neden olabilir. |
| Güvenlik Açıklaması | S9 - Keep container in a well-ventilated place. S16 - Ateşme kaynaklarından uzak tutun. S29 - Do not empty into drains. S36/37/39 Uygun koruyucu giysiler, eldivenler ve göz/yüz koruyucu giyin. S45 - Kaza durumunda veya kendinizi iyi hissetmezseniz, hemen tıbbi tavsiye alın (mümkün olduğunda etiketi gösterin). S61 - Çevre serbest bırakmayı engelleyin.Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML Özel talimatlara / güvenlik veri çarşaflara bakın. Çek! S26 - Gözlerle temas halinde hemen bol miktarda suyla durulayın ve tıbbi tavsiye alın. |
| BM Kimlikleri | UN 2554 3/PG 2 |
| WGK Almanya | 2 |
| RTECS | UC8050000 |
| TSCA'nın | Evet. |
| HS Kodu | 29032900 |
| Tehlike Sınıfı | 3 |
| Paketleme Grubu | II |
| Karcinogen klasifikasyonu | 2B (Vol. 63, 115) 2018 |
| Kullanım | 2-methyl-3-chloropropene, also known as methallyl chloride, is used to synthesize the mite agent phenobylbutylbenzene, an intermediate chlorotert-butylbenzene, It can also be used to synthesize the intermediate furan of the insecticide carbofuran. this product is an important organic intermediate, which can be widely used in medicine, pesticide, perfume, synthetic materials and other fields. It is the main raw material for the synthesis of insecticides such as carbofuran and phenylbutyltin. Organic intermediates are the main raw materials for the synthesis of insecticides such as carbofuran and phenylbutyltin. Used as an intermediate for pesticides, plastics, medicines, etc. Used to synthesize acaricidal tin, sodium methallyl sulfonate, 3-chloro-2-methylpropylene oxide, etc. |
| Üretim yöntemi | 2-methyl-3-chloropropene is prepared by the reaction of isobutylene and liquid chlorine. Isobutylene and liquid chlorine are measured separately after gasification, and then passed into the reactor according to the appropriate ratio. The reaction is strongly exothermic, and the reaction contact time must be strictly controlled, and the reaction is evenly mixed in an instant. After the reaction, the material enters the reaction evaporator, removes the reaction heat, and then enters the absorption condenser, absorbs hydrogen chloride into hydrochloric acid, and then is cooled and separated by oleic acid. Hydrochloric acid can be sold as a by-product, and the organic layer is fractionated to obtain 2-Methyl -3-chloropropene, the content can reach 95% ~ 98%. |
| Kategori | flammable liquid |
| zehirli klasifikasyon | zehirlenmek |
| akūt toksik | oral administration-rat LD50: 848 mg/kg; Oral administration-mouse LDL0: 3160 mg/kg |
| Explosive hazard characteristics | Mix with air to form an explosive mixture; |
| yanılabilirlik tehlike özellikleri | flammability; thermal decomposition of toxic chloride gas |
| depolama ve taşıma özellikleri | warehouse ventilation and low temperature drying; separate from oxidant storage and transportation |
| Ateş söndürme ajanı | foam, dry powder, carbon dioxide, sand |
| occupational standard | STEL 0.3 mg/m3 |
| auto-ignition temperature | 899 °F |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
