107-94-8 - Names and IdentifiersName3-Chloropropionic acidSynonymsNSC 174HSDB 20533-chloropropa
E-posta adresi: info@standard-groups.com
| Adı | 3-Chloropropionic acid |
| Eşanlamlar | NSC 174 HSDB 2053 3-chloropropanoate 3-chloro-propionicaci 3-Chloropropanic acid 3-Chloropropionic acid β-Chloropropionic acid Dapoxetine impurity 27 3-Chloropropanoic acid acide3-chloropropanoique beta-Chloropropionic acid Propanoic acid, 3-chloro- Propionic acid, 3-chloro- Brexpiprazole Impurity 67 beta-monochloropropionicacid beta-Monochloropropionic acid |
| CAS'ın | 107-94-8 |
| EINECS'in | 203-534-4 |
| InChI'nin | InChI=1/C3H5ClO2/c4-2-1-3(5)6/h1-2H2,(H,5,6)/p-1 |
| InChIKey | QEYMMOKECZBKAC-UHFFFAOYSA-N |
| Moleküler Formül | C3H5ClO2 |
| Molar Kütlesi | 108.52 |
| Yoğunluk | 1,27 g/cm3 |
| Erime noktası | 37 °C |
| Boling Point | 203-205°C(lit.) |
| Flash Point | > 230°F |
| Su Solubility | freely soluble |
| Çözünürlük | H2O: soluble50mg/mL, clear, colorless |
| Buhar Basıncı | 0.147mmHg at 25°C |
| Görüntü | Kristallin Aşağı Erime Taşımı |
| Renk | Beyaz ve beyaz |
| Merck'ın | 14,2159 |
| BRN | 1098495 |
| pKa | 3.98(at 25℃) |
| Depolama Koşulları | +30 ° C'nin altında saklayın. |
| Kırılma Endeksi | 1.4380 (estimate) |
| Fiziksel ve Kimyasal Özellikler | physical and chemical properties: White Crystal melting point 37-41°C boiling point 203-205°C Flash noktası 125°C water-soluble freely soluble |
| Kullanım | For organic synthesis, medicine, dyes, pesticide intermediates. |
| Tehlike Simbolleri | C - Corrosive |
| Risk Kodları | R35 - Ciddi yaktırır.Please take the official translations! You find them here: http: // europa. eu. int/ eur- lex/ lex/ LexUriServ/ LexUriServ. do? uri=CELEX: 32001L0059: EN: HTML R34 - Yanıklara neden olur R21/22 Cilt ile temas halinde ve yutularsa zararlı. |
| Güvenlik Açıklaması | S26 - Gözlerle temas halinde hemen bol miktarda suyla durulayın ve tıbbi tavsiye alın. S36/37/39 Uygun koruyucu giysiler, eldivenler ve göz/yüz koruyucu giyin. S45 - Kaza durumunda veya kendinizi iyi hissetmezseniz, hemen tıbbi tavsiye alın (mümkün olduğunda etiketi gösterin). |
| BM Kimlikleri | UN 3261 8/PG 2 |
| WGK Almanya | 1 |
| RTECS | UE8750000 |
| FLUKA MARKA F KODLARI | 3-10 |
| TSCA'nın | Evet. |
| HS Kodu | 29159080 |
| Tehlike Sınıfı | 8 |
| Paketleme Grubu | III |
| Zehirli Materiyaler | Propionic acid |
| Aşağıdaki ürünler | 3-Chloropropionyl chloride |
| LogP'nin | 0.41 |
| Kullanım | organic synthesis intermediate for the production of anti-epileptic pain drugs. used as pesticide and pharmaceutical intermediates used in organic synthesis. |
| üretim yöntemi | There are a variety of preparation methods. Propionic acid is chlorinated to 3-chloropropionic acid at about 20 °c under ultraviolet light; Very small amounts of hydroquinone may also be added to the acrylic acid and then reacted below 20 °c with dry hydrogen chloride. The final product was obtained by distillation under reduced pressure. Further, acrylonitrile was added to hot hydrochloric acid, and the reaction was conducted under reflux for 6 hours. The reactant was cooled, the resulting ammonium chloride was filtered, extracted with diethyl ether, washed with 20% ammonium chloride solution to remove hydrochloric acid, and dried to recover diethyl ether, followed by distillation under reduced pressure to obtain 3-chloropropionic acid. 3-chloropropionic acid can also be prepared by reacting acrolein with hydrogen chloride to form chloropropionaldehyde, followed by nitric acid oxidation, or by nitric acid oxidation of 3-chloro-1-propanol. |
| Kategori | corrosive article |
| zehirli sınıf | yüksek toksiklik |
| Akut toksisite | subcutaneous-mouse LDL0: 1040 mg/kg |
| yanılabilirlik tehlike özellikleri | flammable; Toxic chloride smoke generated by heating |
| depolama ve taşıma özellikleri | The warehouse is ventilated and dried at low temperature; It is stored separately from oxidants and alkalis. |
| Ateş söndürme ajanı | Sand, foam, water mist, carbon dioxide |
| Occupational Standard | SEL 5 mg/m3 |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
