2,5-hexanedione is an important organic chemical intermediate, which is widely used in medicine, spi
E-posta adresi: info@standard-groups.com
Advantage of 2,5-HEXANEDIONE CAS No. 110-13-4 Colorless liquid It can be miscible with water, ethanol and ether Convenient storage
2,5-hexanedione is an important organic chemical intermediate, which is widely used in medicine, spices, pesticides, photographic agents, electroplating and painting and other fields.
Üretim İsmi
2,5-HEXANEDIONE
Çoklu İsim
2,5-Hexanedione;
2,5-Diketohexane;
2,5-Hexadione;
Acetone, Acetonyl-;
Acetonyl Acetone 2,5-Hexanedione;
2,5-Dioxohexane;
2,5-Hexanedione, Standard f Gc;
Acetonylacetone,97%;
Nsc 7621
CAS No. 110-13-4
EC No. 203-738-3
MF No. C6H10O2
MW No. 114.1424
| Adı | 2,5-Hexanedione |
| Eşanlamlar | NSC 7621 2,5-Hexadione Hexan-2,5-Dion Acetonylacetone 2,5-Hexanedione 2,5-Dioxohexane hexane-2,5-dione 2,5-Diketohexane Acetone, acetonyl- 2,5-Hexanedione, Standard f GC Acetonyl acetone 2,5-hexanedione |
| CAS'ın | 110-13-4 |
| EINECS'in | 203-738-3 |
| InChI'nin | InChI=1/C6H10O2/c1-5(7)3-4-6(2)8/h3-4H2,1-2H3 |
| InChIKey | OJVAMHKKJGICOG-UHFFFAOYSA-N |
| Moleküler Formül | C6H10O2 |
| Molar Kütlesi | 114.14 |
| Yoğunluk | 0.973 g/mL at 25 °C (lit.) |
| Erime noktası | -6--5 °C (lit.) |
| Boling Point | 191 °C (lit.) |
| Özel Dönüş (α) | n20/D 1.425 (lit.) |
| Flash Point | 174°F |
| Su Solubility | yanlış |
| Çözünürlük | It can be miscible with water and ethanol ether, not with hydrocarbon solvents. |
| Buhar Basıncı | 0.43 mm Hg ( 20 °C) |
| Görüntü | Transparent light brown liquid |
| Renk | Clear yellow to brown |
| Merck'ın | 14,71 |
| BRN | 506525 |
| PH | 6.1 (10g/l, H2O, 20℃) |
| Depolama Koşulları | +30 ° C'nin altında saklayın. |
| Kararlılık | Stable. Incompatible with strong bases, strong reducing agents, strong oxidizing agents. Flammable. |
| Patlayıcı Sınır | 1.5%(V) |
| Kırılma Endeksi | n20/D 1.425(lit.) |
| MDL'nin | MFCD00008792 |
| Fiziksel ve Kimyasal Özellikler | Colorless liquid. Melting Point -5.5 ℃, boiling point 194 ℃(100.5kPa),89 ℃(3.33kPa), relative density 0.9737(20/4 ℃), refractive index 1.4421. Can be miscible with water, ethanol, ether. It gradually turned yellow after long-standing. |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
