It is used to produce cyclopentadiene pesticide and unsaturated polyester resin. It can be used for
E-posta adresi: info@standard-groups.com
Advantage of 2,5-Norbornadiene CAS No. 121-46-0 It is high purity It is good effect in related use It is widely used in demand field
It is used to produce cyclopentadiene pesticide and unsaturated polyester resin. It can be used for the synthesis of optical storage materials.
Üretim İsmi
2,5-Norbornadiene
Çoklu İsim
2,5-Norbornadiene;
Bicyclo[2.2.1]Hepta-2,5-Diene
CAS No. 121-46-0
EC No. 204-472-0
MF No. C7H8
MW No. 92.1384
| Adı | Bicyclo[2.2.1]hepta-2,5-diene |
| Eşanlamlar | 2,5-Norbornadiene Bicycloheptadiene Bicyclo[2.2.1]hepta-2,5-diene (1s,4s)-Bbicyclo[2.2.1]hepta-2,5-diene Bicyclo[2.2.1]hepta-2,5-diene, stabilized Bicycol(2.2.1)hepta-2.5-diene (2.5-norbornadiene) |
| CAS'ın | 121-46-0 |
| EINECS'in | 204-472-0 |
| InChI'nin | InChI=1/C7H8/c1-2-7-4-3-6(1)5-7/h1-2H,3-5H2 |
| InChIKey | SJYNFBVQFBRSIB-UHFFFAOYSA-N |
| Moleküler Formül | C7H8 |
| Molar Kütlesi | 92.14 |
| Yoğunluk | 0.906g/mLat 25°C(lit.) |
| Erime noktası | -20--19°C |
| Boling Point | 89°C(lit.) |
| Flash Point | 12°F |
| Su Solubility | Immiscible with water. |
| Buhar Basıncı | 69 hPa (20 °C) |
| Görüntü | A liquid |
| Renk | Renksiz Neredeyse Renksiz |
| Maksimum dalga uzunluğu( λmax) | ['195nm(EtOH)(lit.)'] |
| BRN | 506224 |
| Depolama Koşulları | +30 ° C'nin altında saklayın. |
| Patlayıcı Sınır | 1.6-6.3%(V) |
| Kırılma Endeksi | n20/D 1.470(lit.) |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
