Chemical Name: 3'-ChloropropiophenoneCAS No.: 34841-35-5Assay: ≥99.0% Appearance: White crystal
E-posta adresi: info@standard-groups.com
3'-Chloropropiophenone Usage： Mainly usedOrganic synthesis, pharmaceutical synthesis intermediates, can be used for the synthesis of wellbutrin. 3'-Chloropropiophenone Packaging and Shipping： 25KG/drum or as per buyer requirement. 3'-Chloropropiophenone Storage: Keep container sealed and store in an ventilated, low temperature, dry warehouse, separate from foods and oxidizing agents.
| Adı | 3'-Chloropropiophenone |
| Eşanlamlar | MCPP M-CHLOROPROPIOPHENONE m-chlorophenylacetone 3'-Chloropropiophenone beta-Chloropropiophenone 3-CHLORO-1-PHENYL-PROPANONE 2-Chloroethyl phenyl ketone 3-CHLOROPHENYL ETHYL KETONE (3-CHLOROPHENYL)PROPAN-1-ONE 3-chloro-1-phenylpropan-1-one 3-Chloro-1-phenyl-1-propanone 1-(3-CHLOROPHENYL)-1-PROPANONE 1-(3-Chlorophenyl)-1-propanone 1-(3-chlorophenyl)propan-1-one 1-(4-chlorophenyl)propan-1-one 3-CHLOROPROPIOPHENONE M-CHLORO PROPIOPHENONE 3-Chloro-Propiophenone(M-ChloroProiophenone) |
| CAS'ın | 34841-35-5 |
| EINECS'in | 252-242-3 |
| InChI'nin | InChI=1/C9H9ClO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| InChIKey | PQWGFUFROKIJBO-UHFFFAOYSA-N |
| Moleküler Formül | C9H9ClO |
| Molar Kütlesi | 168.62 |
| Yoğunluk | 1.1115 (rough estimate) |
| Erime noktası | 45-47°C(lit.) |
| Boling Point | 124°C14mm Hg(lit.) |
| Flash Point | > 230°F |
| Çözünürlük | Soluble in methanol. |
| Buhar Basıncı | 0.0266mmHg at 25°C |
| Görüntü | Bright yellow crystal |
| Renk | Beyaz sarı |
| Depolama Koşulları | Kuru, oda sıcaklığı |
| Kırılma Endeksi | 1.5350 (estimate) |
| MDL'nin | MFCD00009925 |
| Fiziksel ve Kimyasal Özellikler | Melting point 43-47°C boiling point 124°C (14 torr) |
| Kullanım | For the synthesis of the drug bupropion |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
