Chemical Name: 3-Methyl-4-nitrobenzoic acidCAS No.: 3113-71-1Assay: ≥98.0% Appearance: White or Yell
E-posta adresi: info@standard-groups.com
3-Methyl-4-nitrobenzoic acid Usage： 3-methyl-4-nitrobenzoic acid is mainly used in organic synthesis intermediates, but also used in medicine, is an important intermediate in the synthesis of antihypertensive drugs telmisartan, and AIDS drugs. 3-Methyl-4-nitrobenzoic acid Packaging and Shipping： 25KG/drum or as per buyer requirement. 3-Methyl-4-nitrobenzoic acid Storage: Storage in the ventilated low-temperature dry warehouse; Keep the container closed and separately from the open flame and heat source.
| Adı | 3-Methyl-4-nitrobenzoic acid |
| Eşanlamlar | RARECHEM AL BO 0346 Methyl-4-nitrobenzoic 4-Nitro-m-toluic acid m-Toluic acid, 4-nitro- 3-methyl-4-nitrobenzoate 3-methyl-4-nitro-benzoicaci 3-Methyl-4-nitrobenzoic acid m-Methyl-p-Nitrobenzoic acid 4-NITRO-3-METHYLBENZOIC ACID 4-Nitro-3-Methyl benzoic acid 3-Methyl-4-nitronbenzoic acid 3-Methy-4-nitrobenzoatic Acid Benzoic acid, 3-methyl-4-nitro- 3-METHYL-4-NITROBENZOIC ACID FOR SYNTHES 5-Carboxy-2-nitrotoluene, 4-Nitro-m-toluic acid |
| CAS'ın | 3113-71-1 |
| EINECS'in | 221-479-4 |
| InChI'nin | InChI=1/C8H7NO4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| InChIKey | XDTTUTIFWDAMIX-UHFFFAOYSA-N |
| Moleküler Formül | C8H7NO4 |
| Molar Kütlesi | 181.15 |
| Yoğunluk | 1.4283 (rough estimate) |
| Erime noktası | 216-218 °C (lit.) |
| Boling Point | 314.24°C (rough estimate) |
| Flash Point | 161.2°C |
| Su Solubility | <0.1 g/100 mL at 22 ºC |
| Çözünürlük | slightly sol. in Alcohol |
| Buhar Basıncı | 1.1E-05mmHg at 25°C |
| Görüntü | Amorphous Powder |
| Renk | Sarı |
| BRN | 1959154 |
| pKa | 3.49±0.10(Predicted) |
| Depolama Koşulları | Kuru, oda sıcaklığı |
| Kırılma Endeksi | 1.5468 (estimate) |
Sorumluluktan vazgeçme: Yukarıdaki içerik yalnızca endüstri içindeki kişiler arasında referans ve iletişim amacıdır ve doğruluğunu veya eksiksizliğini garanti etmez. İlgili yasa ve düzenlemelere ve bu web sitesinin düzenlemelerine göre, ilgili ürünleri satın alan birimler veya bireyler geçerli nitelikler ve nitelik koşulları almalıdır.
Şirket Telefonu
+86-21-6420 0566
Çalışma saatleri
Pazartesi - Cuma
Cep telefonu:
13816217984
E-posta adresi:
info@qinsun-lab.com
